C20H33N5O6 — CID 174828726
2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 174828726) has the molecular formula C20H33N5O6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174828726 |
| Molecular Formula | C20H33N5O6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C14H19NO4.C6H14N4O2/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10;7-4(5(11)12)2-1-3-10-6(8)9/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | VXNOBPWTDUMYHH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 203.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|