C20H30N6O7 — CID 10528199
(2R)-5-[[amino(nitramido)methylidene]amino]-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid (PubChem CID 10528199) has the molecular formula C20H30N6O7 and a molecular weight of 466.50 g/mol. Its IUPAC name is (2R)-5-[[amino(nitramido)methylidene]amino]-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid.
| Compound Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10528199 |
| Molecular Formula | C20H30N6O7 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (2R)-5-[[amino(nitramido)methylidene]amino]-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)N[C@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C20H30N6O7/c1-20(2,3)33-19(30)24-15(12-13-8-5-4-6-9-13)16(27)23-14(17(28)29)10-7-11-22-18(21)25-26(31)32/h4-6,8-9,14-15H,7,10-12H2,1-3H3,(H,23,27)(H,24,30)(H,28,29)(H3,21,22,25)/t14-,15-/m1/s1 |
| InChIKey | XXOJBQOZYNOJKR-HUUCEWRRSA-N |
| XLogP | 0.57 |
| TPSA | 198.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|