C11H22N5O6+ — CID 86222746
[[N'-[(4R)-4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]amino]-hydroxy-oxoazanium (PubChem CID 86222746) has the molecular formula C11H22N5O6+ and a molecular weight of 320.33 g/mol. Its IUPAC name is [[N'-[(4R)-4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]amino]-hydroxy-oxoazanium.
| Compound Name | [[N'-[(4R)-4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 86222746 |
| Molecular Formula | C11H22N5O6+ |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [[N'-[(4R)-4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamimidoyl]amino]-hydroxy-oxoazanium |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC/N=C(\N)N[N+](=O)O)C(=O)O |
| InChI | InChI=1S/C11H21N5O6/c1-11(2,3)22-10(19)14-7(8(17)18)5-4-6-13-9(12)15-16(20)21/h7H,4-6H2,1-3H3,(H5-,12,13,14,15,17,18,19,20,21)/p+1/t7-/m1/s1 |
| InChIKey | XXKAJBUPLKYEGR-SSDOTTSWSA-O |
| XLogP | -0.27 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|