C13H22N2O6 — CID 10709470
(2S)-5-(1-carboxyethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 10709470) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-5-(1-carboxyethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-(1-carboxyethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 10709470 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S)-5-(1-carboxyethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | C/C(=N\CCC[C@H](NC(=O)OC(C)(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c1-8(10(16)17)14-7-5-6-9(11(18)19)15-12(20)21-13(2,3)4/h9H,5-7H2,1-4H3,(H,15,20)(H,16,17)(H,18,19)/b14-8+/t9-/m0/s1 |
| InChIKey | BSAPJVXXNJQNPH-PFMRQGHBSA-N |
| XLogP | 1.29 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|