C11H20INO4 — CID 87274670
(2S)-6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 87274670) has the molecular formula C11H20INO4 and a molecular weight of 357.19 g/mol. Its IUPAC name is (2S)-6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 87274670 |
| Molecular Formula | C11H20INO4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (2S)-6-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCI)C(=O)O |
| InChI | InChI=1S/C11H20INO4/c1-11(2,3)17-10(16)13-8(9(14)15)6-4-5-7-12/h8H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | PETBVVVTTYNXGO-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|