C19H36INO4 — CID 19930840
ethyl 12-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodecanoate (PubChem CID 19930840) has the molecular formula C19H36INO4 and a molecular weight of 469.40 g/mol. Its IUPAC name is ethyl 12-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodecanoate.
| Compound Name | ethyl 12-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodecanoate |
|---|---|
| PubChem CID | 19930840 |
| Molecular Formula | C19H36INO4 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | ethyl 12-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodecanoate |
| SMILES | CCOC(=O)C(CCCCCCCCCCI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H36INO4/c1-5-24-17(22)16(21-18(23)25-19(2,3)4)14-12-10-8-6-7-9-11-13-15-20/h16H,5-15H2,1-4H3,(H,21,23) |
| InChIKey | STXILXOADQVUSI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|