C18H32INO6 — CID 58185184
dimethyl (2S,4S)-2-(6-iodohexyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 58185184) has the molecular formula C18H32INO6 and a molecular weight of 485.36 g/mol. Its IUPAC name is dimethyl (2S,4S)-2-(6-iodohexyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | dimethyl (2S,4S)-2-(6-iodohexyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 58185184 |
| Molecular Formula | C18H32INO6 |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | dimethyl (2S,4S)-2-(6-iodohexyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | COC(=O)[C@@H](CCCCCCI)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H32INO6/c1-18(2,3)26-17(23)20-14(16(22)25-5)12-13(15(21)24-4)10-8-6-7-9-11-19/h13-14H,6-12H2,1-5H3,(H,20,23)/t13-,14-/m0/s1 |
| InChIKey | QBXMJNAYROZXML-KBPBESRZSA-N |
| XLogP | 3.62 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|