C14H23NO8 — CID 10806529
trimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate (PubChem CID 10806529) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is trimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate.
| Compound Name | trimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 10806529 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | trimethyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propane-1,1,3-tricarboxylate |
| SMILES | COC(=O)C(C[C@H](NC(=O)OC(C)(C)C)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H23NO8/c1-14(2,3)23-13(19)15-9(12(18)22-6)7-8(10(16)20-4)11(17)21-5/h8-9H,7H2,1-6H3,(H,15,19)/t9-/m0/s1 |
| InChIKey | ZARNUPMKLCNEMM-VIFPVBQESA-N |
| XLogP | 0.41 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|