C20H34N2O8 — CID 10717511
dimethyl (E)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-enedioate (PubChem CID 10717511) has the molecular formula C20H34N2O8 and a molecular weight of 430.50 g/mol. Its IUPAC name is dimethyl (E)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-enedioate.
| Compound Name | dimethyl (E)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-enedioate |
|---|---|
| PubChem CID | 10717511 |
| Molecular Formula | C20H34N2O8 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | dimethyl (E)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-enedioate |
| SMILES | COC(=O)C(C/C=C/CC(NC(=O)OC(C)(C)C)C(=O)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34N2O8/c1-19(2,3)29-17(25)21-13(15(23)27-7)11-9-10-12-14(16(24)28-8)22-18(26)30-20(4,5)6/h9-10,13-14H,11-12H2,1-8H3,(H,21,25)(H,22,26)/b10-9+ |
| InChIKey | QHNCZFMQJLHRON-MDZDMXLPSA-N |
| XLogP | 2.46 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|