C20H37NO4 — CID 10665908
tert-butyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]undec-4-enoate (PubChem CID 10665908) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is tert-butyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]undec-4-enoate.
| Compound Name | tert-butyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]undec-4-enoate |
|---|---|
| PubChem CID | 10665908 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | tert-butyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]undec-4-enoate |
| SMILES | CCCCCC/C=C/CC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO4/c1-8-9-10-11-12-13-14-15-16(17(22)24-19(2,3)4)21-18(23)25-20(5,6)7/h13-14,16H,8-12,15H2,1-7H3,(H,21,23)/b14-13+ |
| InChIKey | DLKGTEBQRBYNIS-BUHFOSPRSA-N |
| XLogP | 5.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|