C25H39NO4 — CID 134976586
methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonadec-12-en-4,10-diynoate (PubChem CID 134976586) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonadec-12-en-4,10-diynoate.
| Compound Name | methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonadec-12-en-4,10-diynoate |
|---|---|
| PubChem CID | 134976586 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonadec-12-en-4,10-diynoate |
| SMILES | CCCCCC/C=C/C#CCCCCC#CC[C@H](NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C25H39NO4/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23(27)29-5)26-24(28)30-25(2,3)4/h11-12,22H,6-10,15-18,21H2,1-5H3,(H,26,28)/b12-11+/t22-/m0/s1 |
| InChIKey | SWDMBAMOFPXJGV-LEQVUBRHSA-N |
| XLogP | 5.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|