C18H28N2O8 — CID 10692349
(2S,7S)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-ynedioic acid (PubChem CID 10692349) has the molecular formula C18H28N2O8 and a molecular weight of 400.43 g/mol. Its IUPAC name is (2S,7S)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-ynedioic acid.
| Compound Name | (2S,7S)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-ynedioic acid |
|---|---|
| PubChem CID | 10692349 |
| Molecular Formula | C18H28N2O8 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (2S,7S)-2,7-bis[(2-methylpropan-2-yl)oxycarbonylamino]oct-4-ynedioic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC#CC[C@H](NC(=O)OC(C)(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H28N2O8/c1-17(2,3)27-15(25)19-11(13(21)22)9-7-8-10-12(14(23)24)20-16(26)28-18(4,5)6/h11-12H,9-10H2,1-6H3,(H,19,25)(H,20,26)(H,21,22)(H,23,24)/t11-,12-/m0/s1 |
| InChIKey | AWJPCHCSJVIQGN-RYUDHWBXSA-N |
| XLogP | 1.73 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|