C12H19NO4 — CID 172868545
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-ynoic acid (PubChem CID 172868545) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-ynoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-ynoic acid |
|---|---|
| PubChem CID | 172868545 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-ynoic acid |
| SMILES | CC#CCC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H19NO4/c1-5-6-7-8-9(10(14)15)13-11(16)17-12(2,3)4/h9H,7-8H2,1-4H3,(H,13,16)(H,14,15)/t9-/m0/s1 |
| InChIKey | RTYQTTRWKDSFCX-VIFPVBQESA-N |
| XLogP | 1.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|