C9H17NO7S — CID 167726879
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfobutanoic acid (PubChem CID 167726879) has the molecular formula C9H17NO7S and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfobutanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 167726879 |
| Molecular Formula | C9H17NO7S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfobutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C9H17NO7S/c1-9(2,3)17-8(13)10-6(7(11)12)4-5-18(14,15)16/h6H,4-5H2,1-3H3,(H,10,13)(H,11,12)(H,14,15,16) |
| InChIKey | FCJSNRNQGYDBPK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|