C12H24N2O6S — CID 146257383
(2R)-6-(methanesulfonamido)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 146257383) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is (2R)-6-(methanesulfonamido)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2R)-6-(methanesulfonamido)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 146257383 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2R)-6-(methanesulfonamido)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCNS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C12H24N2O6S/c1-12(2,3)20-11(17)14-9(10(15)16)7-5-6-8-13-21(4,18)19/h9,13H,5-8H2,1-4H3,(H,14,17)(H,15,16)/t9-/m1/s1 |
| InChIKey | YTTOAYMHKFGMMG-SECBINFHSA-N |
| XLogP | 0.68 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|