C13H27N2O4+ — CID 87539933
[4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-trimethylazanium (PubChem CID 87539933) has the molecular formula C13H27N2O4+ and a molecular weight of 275.37 g/mol. Its IUPAC name is [4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-trimethylazanium.
| Compound Name | [4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-trimethylazanium |
|---|---|
| PubChem CID | 87539933 |
| Molecular Formula | C13H27N2O4+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | [4-carboxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-trimethylazanium |
| SMILES | CC(C)(C)OC(=O)NC(CCC[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H26N2O4/c1-13(2,3)19-12(18)14-10(11(16)17)8-7-9-15(4,5)6/h10H,7-9H2,1-6H3,(H-,14,16,17,18)/p+1 |
| InChIKey | CMFGYSRWSGBRNF-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|