C8H14FNO6S — CID 139806912
3-fluorosulfonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 139806912) has the molecular formula C8H14FNO6S and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-fluorosulfonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-fluorosulfonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 139806912 |
| Molecular Formula | C8H14FNO6S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-fluorosulfonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CS(=O)(=O)F)C(=O)O |
| InChI | InChI=1S/C8H14FNO6S/c1-8(2,3)16-7(13)10-5(6(11)12)4-17(9,14)15/h5H,4H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | PSSDHJXHNCJJRY-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |