C11H21N3O6S — CID 11404512
3-[[(Z)-1-aminoethylideneamino]methylsulfonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 11404512) has the molecular formula C11H21N3O6S and a molecular weight of 323.37 g/mol. Its IUPAC name is 3-[[(Z)-1-aminoethylideneamino]methylsulfonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[[(Z)-1-aminoethylideneamino]methylsulfonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 11404512 |
| Molecular Formula | C11H21N3O6S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-[[(Z)-1-aminoethylideneamino]methylsulfonyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | C/C(N)=N/CS(=O)(=O)CC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H21N3O6S/c1-7(12)13-6-21(18,19)5-8(9(15)16)14-10(17)20-11(2,3)4/h8H,5-6H2,1-4H3,(H2,12,13)(H,14,17)(H,15,16) |
| InChIKey | IAMHFBVPFVIBBR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|