C11H21NO6S2 — CID 23615133
4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid (PubChem CID 23615133) has the molecular formula C11H21NO6S2 and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid.
| Compound Name | 4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 23615133 |
| Molecular Formula | C11H21NO6S2 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-acetylsulfanyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid |
| SMILES | CC(=O)SCC(CCS(=O)(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO6S2/c1-8(13)19-7-9(5-6-20(15,16)17)12-10(14)18-11(2,3)4/h9H,5-7H2,1-4H3,(H,12,14)(H,15,16,17) |
| InChIKey | YCQUEHSAMOQRGD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|