C23H46N2O10S4 — CID 150234677
4-[[4-(2,2-dimethylpropoxysulfonyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]disulfanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid (PubChem CID 150234677) has the molecular formula C23H46N2O10S4 and a molecular weight of 638.89 g/mol. Its IUPAC name is 4-[[4-(2,2-dimethylpropoxysulfonyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]disulfanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid.
| Compound Name | 4-[[4-(2,2-dimethylpropoxysulfonyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]disulfanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 150234677 |
| Molecular Formula | C23H46N2O10S4 |
| Molecular Weight | 638.89 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 4-[[4-(2,2-dimethylpropoxysulfonyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]disulfanyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butane-1-sulfonic acid |
| SMILES | CC(C)(C)COS(=O)(=O)CCC(CSSCC(CCS(=O)(=O)O)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H46N2O10S4/c1-21(2,3)16-33-39(31,32)13-11-18(25-20(27)35-23(7,8)9)15-37-36-14-17(10-12-38(28,29)30)24-19(26)34-22(4,5)6/h17-18H,10-16H2,1-9H3,(H,24,26)(H,25,27)(H,28,29,30) |
| InChIKey | FWFYUVHNUQWWAL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|