C30H56N2O8S2 — CID 11764688
tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]disulfanyl]hexanoate (PubChem CID 11764688) has the molecular formula C30H56N2O8S2 and a molecular weight of 636.92 g/mol. Its IUPAC name is tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]disulfanyl]hexanoate.
| Compound Name | tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]disulfanyl]hexanoate |
|---|---|
| PubChem CID | 11764688 |
| Molecular Formula | C30H56N2O8S2 |
| Molecular Weight | 636.92 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | tert-butyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]disulfanyl]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCC(CSSCC(CCCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H56N2O8S2/c1-27(2,3)37-23(33)17-13-15-21(31-25(35)39-29(7,8)9)19-41-42-20-22(32-26(36)40-30(10,11)12)16-14-18-24(34)38-28(4,5)6/h21-22H,13-20H2,1-12H3,(H,31,35)(H,32,36) |
| InChIKey | MNNGWMWDKNBKPV-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.92 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|