C17H31NO5 — CID 145043689
tert-butyl (7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate (PubChem CID 145043689) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl (7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate.
| Compound Name | tert-butyl (7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate |
|---|---|
| PubChem CID | 145043689 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | tert-butyl (7S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxooctanoate |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@@H](C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO5/c1-16(2,3)22-14(20)11-9-7-8-10-13(12-19)18-15(21)23-17(4,5)6/h12-13H,7-11H2,1-6H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | SYWQIXRGCKIMBL-ZDUSSCGKSA-N |
| XLogP | 3.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|