C10H19NO3 — CID 10262225
tert-butyl N-[(2S)-1-oxopentan-2-yl]carbamate (PubChem CID 10262225) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10262225 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxopentan-2-yl]carbamate |
| SMILES | CCC[C@@H](C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3/c1-5-6-8(7-12)11-9(13)14-10(2,3)4/h7-8H,5-6H2,1-4H3,(H,11,13)/t8-/m0/s1 |
| InChIKey | POQXUDBUMCSVHF-QMMMGPOBSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|