C9H15F2NO4 — CID 174201322
tert-butyl N-[1-(difluoromethoxy)-3-oxopropan-2-yl]carbamate (PubChem CID 174201322) has the molecular formula C9H15F2NO4 and a molecular weight of 239.22 g/mol. Its IUPAC name is tert-butyl N-[1-(difluoromethoxy)-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(difluoromethoxy)-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 174201322 |
| Molecular Formula | C9H15F2NO4 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | tert-butyl N-[1-(difluoromethoxy)-3-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)COC(F)F |
| InChI | InChI=1S/C9H15F2NO4/c1-9(2,3)16-8(14)12-6(4-13)5-15-7(10)11/h4,6-7H,5H2,1-3H3,(H,12,14) |
| InChIKey | KBWLNDRXNLNHHZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|