C20H40N2O4 — CID 151817419
tert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]decyl]carbamate (PubChem CID 151817419) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]decyl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]decyl]carbamate |
|---|---|
| PubChem CID | 151817419 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | tert-butyl N-[1-[(2-methylpropan-2-yl)oxycarbonylamino]decyl]carbamate |
| SMILES | CCCCCCCCCC(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N2O4/c1-8-9-10-11-12-13-14-15-16(21-17(23)25-19(2,3)4)22-18(24)26-20(5,6)7/h16H,8-15H2,1-7H3,(H,21,23)(H,22,24) |
| InChIKey | SBXBCNPWKDEDGC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|