C17H35NO4 — CID 138976837
tert-butyl N-[(2R,3S)-1,3-dihydroxydodecan-2-yl]carbamate (PubChem CID 138976837) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1,3-dihydroxydodecan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1,3-dihydroxydodecan-2-yl]carbamate |
|---|---|
| PubChem CID | 138976837 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1,3-dihydroxydodecan-2-yl]carbamate |
| SMILES | CCCCCCCCC[C@H](O)[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H35NO4/c1-5-6-7-8-9-10-11-12-15(20)14(13-19)18-16(21)22-17(2,3)4/h14-15,19-20H,5-13H2,1-4H3,(H,18,21)/t14-,15+/m1/s1 |
| InChIKey | XXUBQBFAKUYFOV-CABCVRRESA-N |
| XLogP | 3.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|