C18H37NO3 — CID 21309749
N-[(2S,3R)-1,3-dihydroxyhexadecan-2-yl]acetamide (PubChem CID 21309749) has the molecular formula C18H37NO3 and a molecular weight of 315.50 g/mol. Its IUPAC name is N-[(2S,3R)-1,3-dihydroxyhexadecan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1,3-dihydroxyhexadecan-2-yl]acetamide |
|---|---|
| PubChem CID | 21309749 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | N-[(2S,3R)-1,3-dihydroxyhexadecan-2-yl]acetamide |
| SMILES | CCCCCCCCCCCCC[C@@H](O)[C@H](CO)NC(C)=O |
| InChI | InChI=1S/C18H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-18(22)17(15-20)19-16(2)21/h17-18,20,22H,3-15H2,1-2H3,(H,19,21)/t17-,18+/m0/s1 |
| InChIKey | VIKZAKIJMJLRKT-ZWKOTPCHSA-N |
| XLogP | 3.55 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|