C17H35NO3 — CID 54071291
N-(1,3-dihydroxypentadecan-2-yl)acetamide (PubChem CID 54071291) has the molecular formula C17H35NO3 and a molecular weight of 301.47 g/mol. Its IUPAC name is N-(1,3-dihydroxypentadecan-2-yl)acetamide.
| Compound Name | N-(1,3-dihydroxypentadecan-2-yl)acetamide |
|---|---|
| PubChem CID | 54071291 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | N-(1,3-dihydroxypentadecan-2-yl)acetamide |
| SMILES | CCCCCCCCCCCCC(O)C(CO)NC(C)=O |
| InChI | InChI=1S/C17H35NO3/c1-3-4-5-6-7-8-9-10-11-12-13-17(21)16(14-19)18-15(2)20/h16-17,19,21H,3-14H2,1-2H3,(H,18,20) |
| InChIKey | MGQBWOZECDIZTE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|