C15H31NO3 — CID 91698916
tert-butyl N-[(4S,5S)-5-hydroxy-2-methylnonan-4-yl]carbamate (PubChem CID 91698916) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-5-hydroxy-2-methylnonan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-5-hydroxy-2-methylnonan-4-yl]carbamate |
|---|---|
| PubChem CID | 91698916 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | tert-butyl N-[(4S,5S)-5-hydroxy-2-methylnonan-4-yl]carbamate |
| SMILES | CCCC[C@H](O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31NO3/c1-7-8-9-13(17)12(10-11(2)3)16-14(18)19-15(4,5)6/h11-13,17H,7-10H2,1-6H3,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | PEWWRMYXFMSTHK-STQMWFEESA-N |
| XLogP | 3.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |