C14H26Cl3NO3 — CID 10872166
tert-butyl N-[(4S,5S)-8,8,8-trichloro-5-hydroxy-2-methyloctan-4-yl]carbamate (PubChem CID 10872166) has the molecular formula C14H26Cl3NO3 and a molecular weight of 362.73 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-8,8,8-trichloro-5-hydroxy-2-methyloctan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-8,8,8-trichloro-5-hydroxy-2-methyloctan-4-yl]carbamate |
|---|---|
| PubChem CID | 10872166 |
| Molecular Formula | C14H26Cl3NO3 |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | tert-butyl N-[(4S,5S)-8,8,8-trichloro-5-hydroxy-2-methyloctan-4-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@@H](O)CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H26Cl3NO3/c1-9(2)8-10(11(19)6-7-14(15,16)17)18-12(20)21-13(3,4)5/h9-11,19H,6-8H2,1-5H3,(H,18,20)/t10-,11-/m0/s1 |
| InChIKey | UNRZEHCCKQFNPE-QWRGUYRKSA-N |
| XLogP | 4.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|