C14H26NO3+ — CID 153432718
tert-butyl N-[(3R,4S)-3-hydroxy-2-methyl-6-methylhept-1-en-4-yl]carbamate (PubChem CID 153432718) has the molecular formula C14H26NO3+ and a molecular weight of 256.37 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-3-hydroxy-2-methyl-6-methylhept-1-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-3-hydroxy-2-methyl-6-methylhept-1-en-4-yl]carbamate |
|---|---|
| PubChem CID | 153432718 |
| Molecular Formula | C14H26NO3+ |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | tert-butyl N-[(3R,4S)-3-hydroxy-2-methyl-6-methylhept-1-en-4-yl]carbamate |
| SMILES | C=C([CH2+])[C@@H](O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO3/c1-9(2)8-11(12(16)10(3)4)15-13(17)18-14(5,6)7/h9,11-12,16H,3-4,8H2,1-2,5-7H3/p+1/t11-,12+/m0/s1 |
| InChIKey | ULBARCUJUZATJF-NWDGAFQWSA-O |
| XLogP | 2.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|