C17H31F2NO4 — CID 134945268
ethyl (3S)-2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate (PubChem CID 134945268) has the molecular formula C17H31F2NO4 and a molecular weight of 351.43 g/mol. Its IUPAC name is ethyl (3S)-2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate.
| Compound Name | ethyl (3S)-2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate |
|---|---|
| PubChem CID | 134945268 |
| Molecular Formula | C17H31F2NO4 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | ethyl (3S)-2,2-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]decanoate |
| SMILES | CCCCCCC[C@H](NC(=O)OC(C)(C)C)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C17H31F2NO4/c1-6-8-9-10-11-12-13(17(18,19)14(21)23-7-2)20-15(22)24-16(3,4)5/h13H,6-12H2,1-5H3,(H,20,22)/t13-/m0/s1 |
| InChIKey | AMDORBJPBOGXMX-ZDUSSCGKSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|