C21H39NO6 — CID 175521717
ethyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxymethyl]octanoate (PubChem CID 175521717) has the molecular formula C21H39NO6 and a molecular weight of 401.54 g/mol. Its IUPAC name is ethyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxymethyl]octanoate.
| Compound Name | ethyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxymethyl]octanoate |
|---|---|
| PubChem CID | 175521717 |
| Molecular Formula | C21H39NO6 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | ethyl 2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxymethyl]octanoate |
| SMILES | CCCCCCC(COC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C21H39NO6/c1-8-10-11-12-13-16(18(23)26-9-2)14-27-19(24)17(15(3)4)22-20(25)28-21(5,6)7/h15-17H,8-14H2,1-7H3,(H,22,25)/t16?,17-/m0/s1 |
| InChIKey | MFVSHLPTWGDSRH-DJNXLDHESA-N |
| XLogP | 4.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|