C23H40N2O10 — CID 54479661
2,3-bis[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxy]propanoic acid (PubChem CID 54479661) has the molecular formula C23H40N2O10 and a molecular weight of 504.58 g/mol. Its IUPAC name is 2,3-bis[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxy]propanoic acid.
| Compound Name | 2,3-bis[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxy]propanoic acid |
|---|---|
| PubChem CID | 54479661 |
| Molecular Formula | C23H40N2O10 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2,3-bis[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxy]propanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCC(OC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C23H40N2O10/c1-12(2)15(24-20(30)34-22(5,6)7)18(28)32-11-14(17(26)27)33-19(29)16(13(3)4)25-21(31)35-23(8,9)10/h12-16H,11H2,1-10H3,(H,24,30)(H,25,31)(H,26,27)/t14?,15-,16-/m0/s1 |
| InChIKey | XOCOYEGOFUEIAH-YVZMLIKISA-N |
| XLogP | 2.62 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|