C20H41NO5Si — CID 71472771
tri(propan-2-yl)silyloxymethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 71472771) has the molecular formula C20H41NO5Si and a molecular weight of 403.64 g/mol. Its IUPAC name is tri(propan-2-yl)silyloxymethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | tri(propan-2-yl)silyloxymethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 71472771 |
| Molecular Formula | C20H41NO5Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | tri(propan-2-yl)silyloxymethyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H41NO5Si/c1-13(2)17(21-19(23)26-20(9,10)11)18(22)24-12-25-27(14(3)4,15(5)6)16(7)8/h13-17H,12H2,1-11H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | MBAYQPCSSNENLJ-KRWDZBQOSA-N |
| XLogP | 5.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|