C16H28ClNO7 — CID 172701864
2-(1-chloroethoxycarbonyloxy)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 172701864) has the molecular formula C16H28ClNO7 and a molecular weight of 381.85 g/mol. Its IUPAC name is 2-(1-chloroethoxycarbonyloxy)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 2-(1-chloroethoxycarbonyloxy)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 172701864 |
| Molecular Formula | C16H28ClNO7 |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(1-chloroethoxycarbonyloxy)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(Cl)OC(=O)OC(C)COC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H28ClNO7/c1-9(2)12(18-14(20)25-16(5,6)7)13(19)22-8-10(3)23-15(21)24-11(4)17/h9-12H,8H2,1-7H3,(H,18,20)/t10?,11?,12-/m0/s1 |
| InChIKey | DBJNRFVUMFMQLB-MCIGGMRASA-N |
| XLogP | 3.21 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|