C13H25NO4S3 — CID 129048053
3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl]disulfanyl]propanoic acid (PubChem CID 129048053) has the molecular formula C13H25NO4S3 and a molecular weight of 355.55 g/mol. Its IUPAC name is 3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl]disulfanyl]propanoic acid.
| Compound Name | 3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 129048053 |
| Molecular Formula | C13H25NO4S3 |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutyl]disulfanyl]propanoic acid |
| SMILES | CSCCC(CSSCCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO4S3/c1-13(2,3)18-12(17)14-10(5-7-19-4)9-21-20-8-6-11(15)16/h10H,5-9H2,1-4H3,(H,14,17)(H,15,16) |
| InChIKey | GZRZBHFLGJPXOQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|