C15H28N2O6S2 — CID 166331091
3-[2-[[(3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166331091) has the molecular formula C15H28N2O6S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 3-[2-[[(3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[(3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166331091 |
| Molecular Formula | C15H28N2O6S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-[2-[[(3R)-4-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | COC[C@@H](CC(=O)NCCSSCCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O6S2/c1-15(2,3)23-14(21)17-11(10-22-4)9-12(18)16-6-8-25-24-7-5-13(19)20/h11H,5-10H2,1-4H3,(H,16,18)(H,17,21)(H,19,20)/t11-/m1/s1 |
| InChIKey | ZLPOEMDWQHUACY-LLVKDONJSA-N |
| XLogP | 1.89 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|