C19H27FN2O5S2 — CID 167755607
3-[2-[[(3R)-3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 167755607) has the molecular formula C19H27FN2O5S2 and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-[2-[[(3R)-3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[(3R)-3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167755607 |
| Molecular Formula | C19H27FN2O5S2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[2-[[(3R)-3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)NCCSSCCC(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN2O5S2/c1-19(2,3)27-18(26)22-15(13-5-4-6-14(20)11-13)12-16(23)21-8-10-29-28-9-7-17(24)25/h4-6,11,15H,7-10,12H2,1-3H3,(H,21,23)(H,22,26)(H,24,25)/t15-/m1/s1 |
| InChIKey | BLRUZVRVRZWSQM-OAHLLOKOSA-N |
| XLogP | 3.75 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|