C14H19F2NO2 — CID 141111564
tert-butyl N-[(3S)-3-fluoro-3-(3-fluorophenyl)propyl]carbamate (PubChem CID 141111564) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-fluoro-3-(3-fluorophenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-3-fluoro-3-(3-fluorophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 141111564 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | tert-butyl N-[(3S)-3-fluoro-3-(3-fluorophenyl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](F)c1cccc(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c1-14(2,3)19-13(18)17-8-7-12(16)10-5-4-6-11(15)9-10/h4-6,9,12H,7-8H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | OGXSTFLWBBRNCL-LBPRGKRZSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |