C15H20FNO2 — CID 170489856
tert-butyl N-[4-(3-fluorophenyl)but-3-enyl]carbamate (PubChem CID 170489856) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is tert-butyl N-[4-(3-fluorophenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-fluorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170489856 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | tert-butyl N-[4-(3-fluorophenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO2/c1-15(2,3)19-14(18)17-10-5-4-7-12-8-6-9-13(16)11-12/h4,6-9,11H,5,10H2,1-3H3,(H,17,18) |
| InChIKey | FVMOYHZLQBTWNE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|