C15H21NO4 — CID 170490025
tert-butyl N-[4-(2,6-dihydroxyphenyl)but-3-enyl]carbamate (PubChem CID 170490025) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is tert-butyl N-[4-(2,6-dihydroxyphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,6-dihydroxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490025 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | tert-butyl N-[4-(2,6-dihydroxyphenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1c(O)cccc1O |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)20-14(19)16-10-5-4-7-11-12(17)8-6-9-13(11)18/h4,6-9,17-18H,5,10H2,1-3H3,(H,16,19) |
| InChIKey | AYIUZNGVUMMVCM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|