C17H21NO4 — CID 170490740
tert-butyl N-[4-(2,6-diformylphenyl)but-3-enyl]carbamate (PubChem CID 170490740) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl N-[4-(2,6-diformylphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,6-diformylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490740 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | tert-butyl N-[4-(2,6-diformylphenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1c(C=O)cccc1C=O |
| InChI | InChI=1S/C17H21NO4/c1-17(2,3)22-16(21)18-10-5-4-9-15-13(11-19)7-6-8-14(15)12-20/h4,6-9,11-12H,5,10H2,1-3H3,(H,18,21) |
| InChIKey | GQZSGFCVWXSCAC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|