C14H19NO3S — CID 170489867
tert-butyl N-[4-(2-formylthiophen-3-yl)but-3-enyl]carbamate (PubChem CID 170489867) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is tert-butyl N-[4-(2-formylthiophen-3-yl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-formylthiophen-3-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170489867 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | tert-butyl N-[4-(2-formylthiophen-3-yl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccsc1C=O |
| InChI | InChI=1S/C14H19NO3S/c1-14(2,3)18-13(17)15-8-5-4-6-11-7-9-19-12(11)10-16/h4,6-7,9-10H,5,8H2,1-3H3,(H,15,17) |
| InChIKey | FLIWRBOHXJOIQN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|