C16H22ClNO2 — CID 170489959
tert-butyl N-[4-(5-chloro-2-methylphenyl)but-3-enyl]carbamate (PubChem CID 170489959) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is tert-butyl N-[4-(5-chloro-2-methylphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(5-chloro-2-methylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170489959 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | tert-butyl N-[4-(5-chloro-2-methylphenyl)but-3-enyl]carbamate |
| SMILES | Cc1ccc(Cl)cc1C=CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22ClNO2/c1-12-8-9-14(17)11-13(12)7-5-6-10-18-15(19)20-16(2,3)4/h5,7-9,11H,6,10H2,1-4H3,(H,18,19) |
| InChIKey | ZTJPKWCZSACFGQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|