C15H20FNO3 — CID 170490029
tert-butyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-enyl]carbamate (PubChem CID 170490029) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490029 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1cc(O)ccc1F |
| InChI | InChI=1S/C15H20FNO3/c1-15(2,3)20-14(19)17-9-5-4-6-11-10-12(18)7-8-13(11)16/h4,6-8,10,18H,5,9H2,1-3H3,(H,17,19) |
| InChIKey | KATNPLMWSXHOSF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|