C16H22FNO3 — CID 170490332
tert-butyl N-[4-(4-fluoro-3-methoxyphenyl)but-3-enyl]carbamate (PubChem CID 170490332) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is tert-butyl N-[4-(4-fluoro-3-methoxyphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-fluoro-3-methoxyphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490332 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl N-[4-(4-fluoro-3-methoxyphenyl)but-3-enyl]carbamate |
| SMILES | COc1cc(C=CCCNC(=O)OC(C)(C)C)ccc1F |
| InChI | InChI=1S/C16H22FNO3/c1-16(2,3)21-15(19)18-10-6-5-7-12-8-9-13(17)14(11-12)20-4/h5,7-9,11H,6,10H2,1-4H3,(H,18,19) |
| InChIKey | WKXXLLLPIASIIQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|