C16H19F4NO2 — CID 170490954
tert-butyl N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]carbamate (PubChem CID 170490954) has the molecular formula C16H19F4NO2 and a molecular weight of 333.33 g/mol. Its IUPAC name is tert-butyl N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490954 |
| Molecular Formula | C16H19F4NO2 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | tert-butyl N-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F4NO2/c1-15(2,3)23-14(22)21-9-5-4-6-11-7-8-13(17)12(10-11)16(18,19)20/h4,6-8,10H,5,9H2,1-3H3,(H,21,22) |
| InChIKey | XMPUBMNSXQSFNQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|