C15H17F4NO2 — CID 170490689
tert-butyl N-[4-(2,3,5,6-tetrafluorophenyl)but-3-enyl]carbamate (PubChem CID 170490689) has the molecular formula C15H17F4NO2 and a molecular weight of 319.30 g/mol. Its IUPAC name is tert-butyl N-[4-(2,3,5,6-tetrafluorophenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,3,5,6-tetrafluorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490689 |
| Molecular Formula | C15H17F4NO2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | tert-butyl N-[4-(2,3,5,6-tetrafluorophenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C15H17F4NO2/c1-15(2,3)22-14(21)20-7-5-4-6-9-12(18)10(16)8-11(17)13(9)19/h4,6,8H,5,7H2,1-3H3,(H,20,21) |
| InChIKey | NDSIHBHLLIPENL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|