C13H16F4N2O2 — CID 107644133
tert-butyl N-[2-(2,3,5,6-tetrafluoroanilino)ethyl]carbamate (PubChem CID 107644133) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.28 g/mol. Its IUPAC name is tert-butyl N-[2-(2,3,5,6-tetrafluoroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,3,5,6-tetrafluoroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 107644133 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | tert-butyl N-[2-(2,3,5,6-tetrafluoroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H16F4N2O2/c1-13(2,3)21-12(20)19-5-4-18-11-9(16)7(14)6-8(15)10(11)17/h6,18H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | NFGFUTCQMHVTDS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|